Organometallic Compounds
Filtered Search Results
Hexamethyldisilazane, Electronic grade, 99+%, Thermo Scientific™
CAS: 999-97-3 Molecular Formula: C6H19NSi2 Molecular Weight (g/mol): 161.395 MDL Number: MFCD00008259 InChI Key: FFUAGWLWBBFQJT-UHFFFAOYSA-N Synonym: hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl PubChem CID: 13838 ChEBI: CHEBI:85068 IUPAC Name: [dimethyl-(trimethylsilylamino)silyl]methane SMILES: C[Si](C)(C)N[Si](C)(C)C
| PubChem CID | 13838 |
|---|---|
| CAS | 999-97-3 |
| Molecular Weight (g/mol) | 161.395 |
| ChEBI | CHEBI:85068 |
| MDL Number | MFCD00008259 |
| SMILES | C[Si](C)(C)N[Si](C)(C)C |
| Synonym | hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl |
| IUPAC Name | [dimethyl-(trimethylsilylamino)silyl]methane |
| InChI Key | FFUAGWLWBBFQJT-UHFFFAOYSA-N |
| Molecular Formula | C6H19NSi2 |
Tetraallyltin, 96%
CAS: 7393-43-3 Molecular Formula: C12H20Sn Molecular Weight (g/mol): 283.00 MDL Number: MFCD00008637 InChI Key: XJPKDRJZNZMJQM-UHFFFAOYSA-N Synonym: tetraallyltin,tetraallylstannane,tetrallylstannane,stannane, tetra-2-propenyl,stannane, tetraallyl,acmc-209osy,tetrakis prop-2-enyl stannane,stannane,tetra-2-propen-1-yl,tetrakis prop-2-en-1-yl stannane PubChem CID: 81878 IUPAC Name: tetrakis(prop-2-enyl)stannane SMILES: C=CC[Sn](CC=C)(CC=C)CC=C
| PubChem CID | 81878 |
|---|---|
| CAS | 7393-43-3 |
| Molecular Weight (g/mol) | 283.00 |
| MDL Number | MFCD00008637 |
| SMILES | C=CC[Sn](CC=C)(CC=C)CC=C |
| Synonym | tetraallyltin,tetraallylstannane,tetrallylstannane,stannane, tetra-2-propenyl,stannane, tetraallyl,acmc-209osy,tetrakis prop-2-enyl stannane,stannane,tetra-2-propen-1-yl,tetrakis prop-2-en-1-yl stannane |
| IUPAC Name | tetrakis(prop-2-enyl)stannane |
| InChI Key | XJPKDRJZNZMJQM-UHFFFAOYSA-N |
| Molecular Formula | C12H20Sn |
(tert-Butyldimethylsiloxy)acetaldehyde, 90%
CAS: 102191-92-4 Molecular Formula: C8H18O2Si Molecular Weight (g/mol): 174.32 MDL Number: MFCD01321229 InChI Key: MEBFFOKESLAUSJ-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyloxy acetaldehyde,2-tert-butyldimethylsilyl oxy acetaldehyde,2-tert-butyldimethylsilyloxy acetaldehyde,tert-butyldimethylsiloxy acetaldehyde,t-butyldimethylsilyloxyacetaldehyde,2-tert-butyl dimethyl silyl oxyacetaldehyde,acetaldehyde, 1,1-dimethylethyl dimethylsilyl oxy,pubchem20197 PubChem CID: 4187788 SMILES: CC(C)(C)[Si](C)(C)OCC=O
| PubChem CID | 4187788 |
|---|---|
| CAS | 102191-92-4 |
| Molecular Weight (g/mol) | 174.32 |
| MDL Number | MFCD01321229 |
| SMILES | CC(C)(C)[Si](C)(C)OCC=O |
| Synonym | tert-butyldimethylsilyloxy acetaldehyde,2-tert-butyldimethylsilyl oxy acetaldehyde,2-tert-butyldimethylsilyloxy acetaldehyde,tert-butyldimethylsiloxy acetaldehyde,t-butyldimethylsilyloxyacetaldehyde,2-tert-butyl dimethyl silyl oxyacetaldehyde,acetaldehyde, 1,1-dimethylethyl dimethylsilyl oxy,pubchem20197 |
| InChI Key | MEBFFOKESLAUSJ-UHFFFAOYSA-N |
| Molecular Formula | C8H18O2Si |
Silicon(IV) 2-ethylhexanoate, nominally 75% in ethanol
CAS: 67939-81-5 Molecular Formula: C32H60O8Si Molecular Weight (g/mol): 600.909 MDL Number: MFCD00269842 InChI Key: UNKOLEUDCQIVBV-UHFFFAOYSA-N Synonym: silicon 2-ethylhexanoate,tetrakis 2-ethylhexanoic acid, tetraanhydride with silicic acid,2-ethylhexanoic acid tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, 1,1',1,1'-tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, tetraanhydride with silicic acid h4sio4,silicon 2-ethylhexanoate, min. 90,tris 2-ethylhexanoyloxy silyl 2-ethylhexanoate,silicon iv 2-ethylhexanoate in ethanol,silicic acid tetrakis 2-ethylhexanoic tetraanhydride,silicon iv 2-ethylhexanoate, nominally in ethanol PubChem CID: 106984 IUPAC Name: tris(2-ethylhexanoyloxy)silyl 2-ethylhexanoate SMILES: CCCCC(CC)C(=O)O[Si](OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC
| PubChem CID | 106984 |
|---|---|
| CAS | 67939-81-5 |
| Molecular Weight (g/mol) | 600.909 |
| MDL Number | MFCD00269842 |
| SMILES | CCCCC(CC)C(=O)O[Si](OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC |
| Synonym | silicon 2-ethylhexanoate,tetrakis 2-ethylhexanoic acid, tetraanhydride with silicic acid,2-ethylhexanoic acid tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, 1,1',1,1'-tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, tetraanhydride with silicic acid h4sio4,silicon 2-ethylhexanoate, min. 90,tris 2-ethylhexanoyloxy silyl 2-ethylhexanoate,silicon iv 2-ethylhexanoate in ethanol,silicic acid tetrakis 2-ethylhexanoic tetraanhydride,silicon iv 2-ethylhexanoate, nominally in ethanol |
| IUPAC Name | tris(2-ethylhexanoyloxy)silyl 2-ethylhexanoate |
| InChI Key | UNKOLEUDCQIVBV-UHFFFAOYSA-N |
| Molecular Formula | C32H60O8Si |
Chloro(chloromethyl)dimethylsilane, 98%, AcroSeal™
CAS: 1719-57-9 Molecular Formula: C3H8Cl2Si Molecular Weight (g/mol): 143.08 MDL Number: MFCD00000875 InChI Key: ITKVLPYNJQOCPW-UHFFFAOYSA-N Synonym: chloro chloromethyl dimethylsilane,chloromethyl dimethylchlorosilane,chloromethyldimethylchlorosilane,silane, chloro chloromethyl dimethyl,cmdmcs,chloro cholromethyl dimethylsilane,ch3 2sicl ch2cl,chloromethylchlorodimethylsilane,dimethylchloromethylchlorosilane,chloro chloromethyl-dimethylsilane PubChem CID: 74393 IUPAC Name: chloro-(chloromethyl)-dimethylsilane SMILES: C[Si](C)(Cl)CCl
| PubChem CID | 74393 |
|---|---|
| CAS | 1719-57-9 |
| Molecular Weight (g/mol) | 143.08 |
| MDL Number | MFCD00000875 |
| SMILES | C[Si](C)(Cl)CCl |
| Synonym | chloro chloromethyl dimethylsilane,chloromethyl dimethylchlorosilane,chloromethyldimethylchlorosilane,silane, chloro chloromethyl dimethyl,cmdmcs,chloro cholromethyl dimethylsilane,ch3 2sicl ch2cl,chloromethylchlorodimethylsilane,dimethylchloromethylchlorosilane,chloro chloromethyl-dimethylsilane |
| IUPAC Name | chloro-(chloromethyl)-dimethylsilane |
| InChI Key | ITKVLPYNJQOCPW-UHFFFAOYSA-N |
| Molecular Formula | C3H8Cl2Si |
Diethylgermanium dichloride
CAS: 13314-52-8 Molecular Formula: C4H14Cl2Ge Molecular Weight (g/mol): 205.69 MDL Number: MFCD00013589 InChI Key: FVUWAWRMMUJVGO-UHFFFAOYSA-N Synonym: diethylgermanium dichloride,diethyldichlorogermane,diethyldichlorogermanium,dichloro diethyl germane,germane,dichlorodiethyl,acmc-1c1bs,diethylgermanium chloride,dichlorodiethylgermane PubChem CID: 83334 IUPAC Name: dichloro(diethyl)germane SMILES: Cl.Cl.CC[GeH2]CC
| PubChem CID | 83334 |
|---|---|
| CAS | 13314-52-8 |
| Molecular Weight (g/mol) | 205.69 |
| MDL Number | MFCD00013589 |
| SMILES | Cl.Cl.CC[GeH2]CC |
| Synonym | diethylgermanium dichloride,diethyldichlorogermane,diethyldichlorogermanium,dichloro diethyl germane,germane,dichlorodiethyl,acmc-1c1bs,diethylgermanium chloride,dichlorodiethylgermane |
| IUPAC Name | dichloro(diethyl)germane |
| InChI Key | FVUWAWRMMUJVGO-UHFFFAOYSA-N |
| Molecular Formula | C4H14Cl2Ge |
Sodium bis(trimethylsilyl)amide, 98%
CAS: 1070-89-9 Molecular Formula: C6H18NNaSi2 Molecular Weight (g/mol): 183.377 MDL Number: MFCD00009835 InChI Key: WRIKHQLVHPKCJU-UHFFFAOYSA-N Synonym: sodium bis trimethylsilyl amide,n-sodiohexamethyldisilazane,sodium hexamethyldisilazide,nahmds,sodiobis trimethylsilyl amine,sodium bis trimethylsilyl azanide,n-sodium hexamethyldisilazane,sodium-bis trimethylsilyl amide,hexamethyldisilazane sodium salt PubChem CID: 2724254 IUPAC Name: sodium;bis(trimethylsilyl)azanide SMILES: C[Si](C)(C)[N-][Si](C)(C)C.[Na+]
| PubChem CID | 2724254 |
|---|---|
| CAS | 1070-89-9 |
| Molecular Weight (g/mol) | 183.377 |
| MDL Number | MFCD00009835 |
| SMILES | C[Si](C)(C)[N-][Si](C)(C)C.[Na+] |
| Synonym | sodium bis trimethylsilyl amide,n-sodiohexamethyldisilazane,sodium hexamethyldisilazide,nahmds,sodiobis trimethylsilyl amine,sodium bis trimethylsilyl azanide,n-sodium hexamethyldisilazane,sodium-bis trimethylsilyl amide,hexamethyldisilazane sodium salt |
| IUPAC Name | sodium;bis(trimethylsilyl)azanide |
| InChI Key | WRIKHQLVHPKCJU-UHFFFAOYSA-N |
| Molecular Formula | C6H18NNaSi2 |
Dichloromethylvinylsilane, 97%, Thermo Scientific Chemicals
CAS: 124-70-9 MDL Number: MFCD00000492 InChI Key: YLJJAVFOBDSYAN-UHFFFAOYSA-N Synonym: dichloro methyl vinyl silane,methylvinyldichlorosilane,silane, dichloroethenylmethyl,vinylmethyldichlorosilane,methyldichlorovinylsilane,silane, dichloromethylvinyl,unii-b27y6f24py,ccris 2457,dichloromethylvinyl-silan,dichloromethylvinyl silane PubChem CID: 31299 IUPAC Name: dichloro-ethenyl-methylsilane SMILES: C[Si](C=C)(Cl)Cl
| PubChem CID | 31299 |
|---|---|
| CAS | 124-70-9 |
| MDL Number | MFCD00000492 |
| SMILES | C[Si](C=C)(Cl)Cl |
| Synonym | dichloro methyl vinyl silane,methylvinyldichlorosilane,silane, dichloroethenylmethyl,vinylmethyldichlorosilane,methyldichlorovinylsilane,silane, dichloromethylvinyl,unii-b27y6f24py,ccris 2457,dichloromethylvinyl-silan,dichloromethylvinyl silane |
| IUPAC Name | dichloro-ethenyl-methylsilane |
| InChI Key | YLJJAVFOBDSYAN-UHFFFAOYSA-N |
Vinyloxytrimethylsilane, 97%
CAS: 6213-94-1 Molecular Formula: C5H12OSi Molecular Weight (g/mol): 116.24 MDL Number: MFCD00054764 InChI Key: HFTNNOZFRQLFQB-UHFFFAOYSA-N Synonym: trimethyl vinyloxy silane,vinyloxytrimethylsilane,silane, ethenyloxy trimethyl,tmso-ethene,vinyloxy-trimethylsilane,trimethylsiloxy ethylene,snqhhgciiezjp@,acmc-209mzx,ethenoxy trimethyl silane,trimethylsilyl vinyl ether PubChem CID: 80344 IUPAC Name: ethenoxy(trimethyl)silane SMILES: C[Si](C)(C)OC=C
| PubChem CID | 80344 |
|---|---|
| CAS | 6213-94-1 |
| Molecular Weight (g/mol) | 116.24 |
| MDL Number | MFCD00054764 |
| SMILES | C[Si](C)(C)OC=C |
| Synonym | trimethyl vinyloxy silane,vinyloxytrimethylsilane,silane, ethenyloxy trimethyl,tmso-ethene,vinyloxy-trimethylsilane,trimethylsiloxy ethylene,snqhhgciiezjp@,acmc-209mzx,ethenoxy trimethyl silane,trimethylsilyl vinyl ether |
| IUPAC Name | ethenoxy(trimethyl)silane |
| InChI Key | HFTNNOZFRQLFQB-UHFFFAOYSA-N |
| Molecular Formula | C5H12OSi |
2-(Trimethylsilyl)thiazole, 96%
CAS: 79265-30-8 Molecular Formula: C6H11NSSi Molecular Weight (g/mol): 157.31 MDL Number: MFCD00066274 InChI Key: VJCHUDDPWPQOLH-UHFFFAOYSA-N Synonym: 2-trimethylsilyl thiazole,2-trimethylsilylthiazole,2-trimethylsilyl-1,3-thiazole,thiazole, 2-trimethylsilyl,2-trimethylsilanylthiazole,trimethyl 1,3-thiazol-2-yl silane,2-tms-thiazole,pubchem10262,acmc-209pgq PubChem CID: 588453 IUPAC Name: trimethyl(1,3-thiazol-2-yl)silane SMILES: C[Si](C)(C)C1=NC=CS1
| PubChem CID | 588453 |
|---|---|
| CAS | 79265-30-8 |
| Molecular Weight (g/mol) | 157.31 |
| MDL Number | MFCD00066274 |
| SMILES | C[Si](C)(C)C1=NC=CS1 |
| Synonym | 2-trimethylsilyl thiazole,2-trimethylsilylthiazole,2-trimethylsilyl-1,3-thiazole,thiazole, 2-trimethylsilyl,2-trimethylsilanylthiazole,trimethyl 1,3-thiazol-2-yl silane,2-tms-thiazole,pubchem10262,acmc-209pgq |
| IUPAC Name | trimethyl(1,3-thiazol-2-yl)silane |
| InChI Key | VJCHUDDPWPQOLH-UHFFFAOYSA-N |
| Molecular Formula | C6H11NSSi |
Octyltrichlorosilane, 97%
CAS: 5283-66-9 MDL Number: MFCD00000488 InChI Key: RCHUVCPBWWSUMC-UHFFFAOYSA-N Synonym: trichloro octyl silane,n-octyltrichlorosilane,octyltrichlorosilane,silane, trichlorooctyl,trichloro-n-octylsilane,unii-jv18i1wcu8,jv18i1wcu8,silane, octyltrichloro,octyltrichlorosilane un1801 corrosive PubChem CID: 21354 IUPAC Name: trichloro(octyl)silane SMILES: CCCCCCCC[Si](Cl)(Cl)Cl
| PubChem CID | 21354 |
|---|---|
| CAS | 5283-66-9 |
| MDL Number | MFCD00000488 |
| SMILES | CCCCCCCC[Si](Cl)(Cl)Cl |
| Synonym | trichloro octyl silane,n-octyltrichlorosilane,octyltrichlorosilane,silane, trichlorooctyl,trichloro-n-octylsilane,unii-jv18i1wcu8,jv18i1wcu8,silane, octyltrichloro,octyltrichlorosilane un1801 corrosive |
| IUPAC Name | trichloro(octyl)silane |
| InChI Key | RCHUVCPBWWSUMC-UHFFFAOYSA-N |
Phenyltrimethoxysilane, 85%
CAS: 2996-92-1 Molecular Formula: C9H14O3Si Molecular Weight (g/mol): 198.29 MDL Number: MFCD00025689 InChI Key: ZNOCGWVLWPVKAO-UHFFFAOYSA-N Synonym: phenyltrimethoxysilane,trimethoxy phenyl silane,silane, trimethoxyphenyl,silane, phenyltrimethoxy,unii-21tqe746s9,trimethoxysilyl benzene,benzene, trimethoxysilyl,phenyl trimethoxysilane,phenyl trimethoxy silane,phenyltri methoxy silane PubChem CID: 18137 IUPAC Name: trimethoxy(phenyl)silane SMILES: CO[Si](OC)(OC)C1=CC=CC=C1
| PubChem CID | 18137 |
|---|---|
| CAS | 2996-92-1 |
| Molecular Weight (g/mol) | 198.29 |
| MDL Number | MFCD00025689 |
| SMILES | CO[Si](OC)(OC)C1=CC=CC=C1 |
| Synonym | phenyltrimethoxysilane,trimethoxy phenyl silane,silane, trimethoxyphenyl,silane, phenyltrimethoxy,unii-21tqe746s9,trimethoxysilyl benzene,benzene, trimethoxysilyl,phenyl trimethoxysilane,phenyl trimethoxy silane,phenyltri methoxy silane |
| IUPAC Name | trimethoxy(phenyl)silane |
| InChI Key | ZNOCGWVLWPVKAO-UHFFFAOYSA-N |
| Molecular Formula | C9H14O3Si |
Tri-n-butyltin chloride, 95%, tech.
CAS: 1461-22-9 Molecular Formula: C12H27ClSn Molecular Weight (g/mol): 325.48 MDL Number: MFCD00000521 InChI Key: GCTFWCDSFPMHHS-UHFFFAOYSA-M Synonym: tributyltin chloride,chlorotributyltin,tri-n-butyltin chloride,tributylchlorotin,stannane, tributylchloro,chlorotri-n-butyltin,tri-n-butylchlorotin,tributyl chloro stannane,chlorotributylstannane,tributylstannyl chloride PubChem CID: 15096 ChEBI: CHEBI:79734 IUPAC Name: tributyl(chloro)stannane SMILES: CCCC[Sn](CCCC)(CCCC)Cl
| PubChem CID | 15096 |
|---|---|
| CAS | 1461-22-9 |
| Molecular Weight (g/mol) | 325.48 |
| ChEBI | CHEBI:79734 |
| MDL Number | MFCD00000521 |
| SMILES | CCCC[Sn](CCCC)(CCCC)Cl |
| Synonym | tributyltin chloride,chlorotributyltin,tri-n-butyltin chloride,tributylchlorotin,stannane, tributylchloro,chlorotri-n-butyltin,tri-n-butylchlorotin,tributyl chloro stannane,chlorotributylstannane,tributylstannyl chloride |
| IUPAC Name | tributyl(chloro)stannane |
| InChI Key | GCTFWCDSFPMHHS-UHFFFAOYSA-M |
| Molecular Formula | C12H27ClSn |
Tris(1-methoxy-2-methyl-2-propoxy)bismuth, 99.99% (metals basis)
Molecular Formula: C15H33O6Bi MDL Number: MFCD11113030
| MDL Number | MFCD11113030 |
|---|---|
| Molecular Formula | C15H33O6Bi |
Potassium ethyltrifluoroborate, 97%
CAS: 44248-07-9 Molecular Formula: C2H5BF3K Molecular Weight (g/mol): 135.97 MDL Number: MFCD04112713 InChI Key: GIIPADVFWNGSKY-UHFFFAOYSA-N Synonym: potassium ethyltrifluoroborate,potassium ethyltrifluoroboranuide,potassium ethytrifluoroborate,amtb738,ethyltrifluoroborate potassium salt,potassium ethyl trifluoro borate 1- PubChem CID: 23668491 IUPAC Name: potassium;ethyl(trifluoro)boranuide SMILES: [K+].CC[B-](F)(F)F
| PubChem CID | 23668491 |
|---|---|
| CAS | 44248-07-9 |
| Molecular Weight (g/mol) | 135.97 |
| MDL Number | MFCD04112713 |
| SMILES | [K+].CC[B-](F)(F)F |
| Synonym | potassium ethyltrifluoroborate,potassium ethyltrifluoroboranuide,potassium ethytrifluoroborate,amtb738,ethyltrifluoroborate potassium salt,potassium ethyl trifluoro borate 1- |
| IUPAC Name | potassium;ethyl(trifluoro)boranuide |
| InChI Key | GIIPADVFWNGSKY-UHFFFAOYSA-N |
| Molecular Formula | C2H5BF3K |